| Approval: | none |
|---|---|
| IUPAC PIN: | rac-(3R)-1-(3,5-dichlorophenyl)-3-(methoxymethyl)pyrrolidine-2,5-dione |
| IUPAC name: | (3RS)-1-(3,5-dichlorophenyl)-3-(methoxymethyl)pyrrolidine-2,5-dione 1979 Rules: (3RS)-N-(3,5-dichlorophenyl)-2-(methoxymethyl)succinimide |
| CAS name: | 1-(3,5-dichlorophenyl)-3-(methoxymethyl)-2,5-pyrrolidinedione |
| CAS Reg. No.: | 81949-88-4 |
| Formula: | C12H11Cl2NO3 |
| Activity: | fungicides (dicarboximide) |
| Notes: | There is no ISO common name for this substance; the name “metomeclan” has been used in the literature but it has no official approval. |
| Structure: |  |
| Pronunciation: | mět-ō-mě-klǎn Guide to British pronunciation |
| InChIKey: | GKRWQTZYSYFMOV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H11Cl2NO3/c1-18-6-7-2-11(16)15(12(7)17)10-4-8(13)3-9(14)5-10/h3-5,7H,2,6H2,1H3 |