| Approval: | ISO |
|---|---|
| IUPAC PIN: | 3,3′-(ethane-1,2-diyl)bis[(4Ξ,6Ξ)-4,6-dimethyl-1,3,5-thiadiazinane-2-thione] |
| IUPAC name: | 4,4′,6,6′-tetramethyl-3,3′-ethylenedi-1,3,5-thiadiazinane-2-thione |
| CAS name: | 3,3′-(1,2-ethanediyl)bis[tetrahydro-4,6-dimethyl-2H-1,3,5-thiadiazine-2-thione] |
| CAS Reg. No.: | 3773-49-7 |
| Formula: | C12H22N4S4 |
| Activity: | fungicides (alkylenebis(dithiocarbamate)) |
| Notes: | The name “thiadiazine” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: | |
| Pronunciation: | mǐl-něb Guide to British pronunciation |
| InChIKey: | JZFICWYCTCCINF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H22N4S4/c1-7-13-9(3)19-11(17)15(7)5-6-16-8(2)14-10(4)20-12(16)18/h7-10,13-14H,5-6H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names