| Approval: | WHO INN |
|---|---|
| IUPAC PIN: | N-carbamimidoylmorpholine-4-carboximidamide |
| IUPAC name: | N-carbamimidoylmorpholine-4-carboximidamide or 4-morpholinecarboximidoylguanidine |
| CAS name: | N-(aminoiminomethyl)-4-morpholinecarboximidamide |
| CAS Reg. No.: | 3731-59-7 |
| Formula: | C6H13N5O |
| Activity: | fungicides (guanidine) |
| Notes: | There is no ISO common name for this substance. The name “moroxydine” is approved by the World Health Organization, and is also approved in China (吗啉胍). Derivatives include moroxydine hydrochloride [3160-91-6]. |
| Structure: | |
| Pronunciation: | mor-ǒks-ǐ-dēn Guide to British pronunciation |
| InChIKey: | KJHOZAZQWVKILO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H13N5O/c7-5(8)10-6(9)11-1-3-12-4-2-11/h1-4H2,(H5,7,8,9,10) |
A data sheet from the Compendium of Pesticide Common Names