| Approval: | China |
|---|---|
| IUPAC PIN: | ethyl (2Ξ)-3-amino-2-cyano-3-phenylprop-2-enoate |
| IUPAC name: | ethyl (2EZ)-3-amino-2-cyano-3-phenylprop-2-enoate 1979 Rules: ethyl (2EZ)-3-amino-2-cyano-3-phenylacrylate |
| CAS name: | ethyl 3-amino-2-cyano-3-phenyl-2-propenoate |
| CAS Reg. No.: | 3336-69-4 |
| Formula: | C12H12N2O2 |
| Activity: | fungicides (aminocyanoacrylate) |
| Notes: | There is no ISO common name for this substance; the name “phenamacril” (氰烯菌酯) is approved in China. The name “phenamacril-ethyl” has been used in the literature, but phenamacril is defined as the ethyl ester in GB 4839-2009 Chinese common names for pesticides. |
| Structure: | |
| Pronunciation: | fěn-ǎm-a-krǐl Guide to British pronunciation |
| InChIKey: | YKRQBWKLHCEKQH-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H12N2O2/c1-2-16-12(15)10(8-13)11(14)9-6-4-3-5-7-9/h3-7H,2,14H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names