| Approval: | ISO |
|---|---|
| IUPAC PIN: | S-ethyl [3-(dimethylamino)propyl]carbamothioate |
| IUPAC name: | S-ethyl [3-(dimethylamino)propyl]carbamothioate 1979 Rules: S-ethyl [3-(dimethylamino)propyl]thiocarbamate |
| CAS name: | S-ethyl N-[3-(dimethylamino)propyl]carbamothioate |
| CAS Reg. No.: | 19622-08-3 |
| Formula: | C8H18N2OS |
| Activity: | fungicides (carbamate) |
| Notes: | When this substance is used as a salt, its identity should be stated, for example prothiocarb hydrochloride [19622-19-6]. |
| Structure: |  |
| Pronunciation: | prō-thī-ō-karb Guide to British pronunciation |
| InChIKey: | YRRBXJLFCBCKNW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H18N2OS/c1-4-12-8(11)9-6-5-7-10(2)3/h4-7H2,1-3H3,(H,9,11) |