| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | disodium carbono(dithioperoxo)dithioate |
| IUPAC name: | sodium tetrathio(peroxycarbonate) |
| CAS name: | disodium carbono(dithioperoxo)dithioate or disodium tetrathioperoxycarbonate or sodium thioperoxycarbonate (Na2CS4) |
| CAS Reg. No.: | 7345-69-9 |
| Formula: | CNa2S4 |
| Activity: | fungicides (thiocarbonate) insecticides (thiocarbonate) nematicides (thiocarbonate) |
| Notes: | This substance is considered by the International Organization for Standardization not to require a common name. This substance degrades to form carbon disulfide gas, the biologically active fumigant. |
| Structure: |  |
| Pronunciation: | sō-dē-am tě-tra-thī-ō-kar-ba-nāt Guide to British pronunciation |
| InChIKey: | HZBLLTXMVMMHRJ-UHFFFAOYSA-L |
| InChI: | InChI=1S/CH2S4.2Na/c2-1(3)5-4;;/h4H,(H,2,3);;/q;2*+1/p-2 |