| Approval: | ISO |
|---|---|
| IUPAC PIN: | 1,2,4,5-tetrachloro-3-nitrobenzene |
| IUPAC name: | 1,2,4,5-tetrachloro-3-nitrobenzene |
| CAS name: | 1,2,4,5-tetrachloro-3-nitrobenzene |
| CAS Reg. No.: | 117-18-0 |
| Formula: | C6HCl4NO2 |
| Activity: | fungicides (aromatic) |
| Notes: | The name “TCNB” has been used in the literature, but it has no official approval. |
| Structure: | |
| Pronunciation: | těk-na-zēn Guide to British pronunciation |
| InChIKey: | XQTLDIFVVHJORV-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
A data sheet from the Compendium of Pesticide Common Names