| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2H-[1,3]dithiolo[4,5-b]quinoxaline-2-thione |
| IUPAC name: | 1,3-dithiolo[4,5-b]quinoxaline-2-thione |
| CAS name: | 1,3-dithiolo[4,5-b]quinoxaline-2-thione |
| CAS Reg. No.: | 93-75-4 |
| Formula: | C9H4N2S3 |
| Activity: | acaricides (quinoxaline) fungicides (quinoxaline) |
| Notes: | |
| Structure: | |
| Pronunciation: | thī-ō-kwǐn-ǒks Guide to British pronunciation |
| InChIKey: | ILERPRJWJPJZDN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H4N2S3/c12-9-13-7-8(14-9)11-6-4-2-1-3-5(6)10-7/h1-4H |
A data sheet from the Compendium of Pesticide Common Names