| Approval: | none |
|---|---|
| IUPAC PIN: | 1-(1-{2-[(3-chlorophenyl)methoxy]phenyl}ethenyl)-1H-imidazole |
| IUPAC name: | 3-chlorobenzyl 2-[1-(imidazol-1-yl)vinyl]phenyl ether |
| CAS name: | 1-[1-[2-[(3-chlorophenyl)methoxy]phenyl]ethenyl]-1H-imidazole |
| CAS Reg. No.: | 77175-51-0 |
| Formula: | C18H15ClN2O |
| Activity: | fungicides (imidazole) |
| Notes: | There is no ISO common name for this substance; the name “viniconazole” has been used in the literature but it has no official approval. The name “croconazole” is approved by the World Health Organization; the Chinese version is “氯康唑” and the Russian version is “кроконазол”. |
| Structure: | |
| Pronunciation: | vī-nǐ-kǒn-a-zōl Guide to British pronunciation |
| InChIKey: | WHPAGCJNPTUGGD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H15ClN2O/c1-14(21-10-9-20-13-21)17-7-2-3-8-18(17)22-12-15-5-4-6-16(19)11-15/h2-11,13H,1,12H2 |
A data sheet from the Compendium of Pesticide Common Names