Approval: | none |
---|---|
IUPAC PIN: | methyl 2,5-dichlorobenzoate |
IUPAC name: | methyl 2,5-dichlorobenzoate |
CAS name: | methyl 2,5-dichlorobenzoate |
CAS Reg. No.: | 2905-69-3 |
Formula: | C8H6Cl2O2 |
Activity: | fungicides (unclassified) plant growth regulators (unclassified) |
Notes: | This substance is a derivative of 2,5-dichlorobenzoic acid [50-70-3]. |
Structure: | |
Pronunciation: | Guide to British pronunciation |
InChIKey: | SPJQBGGHUDNAIC-UHFFFAOYSA-N |
InChI: | InChI=1S/C8H6Cl2O2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3 |
A data sheet from the Compendium of Pesticide Common Names